CAS 1384881-65-5 is the registry number for 3,3-Bis(4-bromobenzyl)pent-4-en-1-ol. Offered by: TRC. Available pack sizes: 1g.
3,3-bis[(4-bromophenyl)methyl]pent-4-en-1-ol (CAS 1384881-65-5) is a chemical compound with the molecular formula C19H20Br2O and a molecular weight of 424.2 g/mol. IUPAC name: 3,3-bis[(4-bromophenyl)methyl]pent-4-en-1-ol. InChIKey: QWWPTPOEDDLPKO-UHFFFAOYSA-N.
| Molecular formula | C19H20Br2O |
|---|---|
| Molecular weight | 424.2 g/mol |
| IUPAC name | 3,3-bis[(4-bromophenyl)methyl]pent-4-en-1-ol |
| InChIKey | QWWPTPOEDDLPKO-UHFFFAOYSA-N |
| SMILES | C=CC(CCO)(CC1=CC=C(C=C1)Br)CC2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)