CAS 138495-42-8 appears in our catalog under these names: 2H,3H-Decafluoropentane, 98%, 2H,3H–Decafluoropentane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100g, 25g, 5g, 500g.
1,1,1,2,2,3,4,5,5,5-decafluoropentane (CAS 138495-42-8) is a chemical compound with the molecular formula C5H2F10 and a molecular weight of 252.05 g/mol. IUPAC name: 1,1,1,2,2,3,4,5,5,5-decafluoropentane. InChIKey: RIQRGMUSBYGDBL-UHFFFAOYSA-N.
| Molecular formula | C5H2F10 |
|---|---|
| Molecular weight | 252.05 g/mol |
| IUPAC name | 1,1,1,2,2,3,4,5,5,5-decafluoropentane |
| InChIKey | RIQRGMUSBYGDBL-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)F)(C(C(F)(F)F)(F)F)F |
Computed by PubChem (NCBI)