Products 1385696-83-2

CAS 1385696-83-2 is the registry number for 4-(2-(Trifluoromethyl)benzyl)tetrahydro-2h-pyran-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

4-[[2-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid (CAS 1385696-83-2) is a chemical compound with the molecular formula C14H15F3O3 and a molecular weight of 288.26 g/mol. IUPAC name: 4-[[2-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid. InChIKey: CUJNTKZMENTSPV-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15F3O3
Molecular weight288.26 g/mol
IUPAC name4-[[2-(trifluoromethyl)phenyl]methyl]oxane-4-carboxylic acid
InChIKeyCUJNTKZMENTSPV-UHFFFAOYSA-N
SMILESC1COCCC1(CC2=CC=CC=C2C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)