Products 13859-31-9

CAS 13859-31-9 is the registry number for 2-Bromotetrafluoropropionic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

2-bromo-2,3,3,3-tetrafluoropropanoic acid (CAS 13859-31-9) is a chemical compound with the molecular formula C3HBrF4O2 and a molecular weight of 224.94 g/mol. IUPAC name: 2-bromo-2,3,3,3-tetrafluoropropanoic acid. InChIKey: QUWQIQACQOVGDT-UHFFFAOYSA-N.

Identity
Molecular formulaC3HBrF4O2
Molecular weight224.94 g/mol
IUPAC name2-bromo-2,3,3,3-tetrafluoropropanoic acid
InChIKeyQUWQIQACQOVGDT-UHFFFAOYSA-N
SMILESC(=O)(C(C(F)(F)F)(F)Br)O

Computed by PubChem (NCBI)