Products 138642-62-3

CAS 138642-62-3 appears in our catalog under these names: 2–Cyanobenzeneboronic acid, 2-Cyanophenylboronic acid pinacol ester/ 95+%, 2-Cyanophenylboronic Acid (contains varying amounts of Anhydride), 2-Cyanophenylboronic acid, 98%, 2-CYANOPHENYLBORONIC ACID. Offered by: GLPBio, Chemat, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g, 100mg, 250mg, 10g, 100g, 5 g.

Structural formula: {0} (CAS {1})

(2-cyanophenyl)boronic acid (CAS 138642-62-3) is a chemical compound with the molecular formula C7H6BNO2 and a molecular weight of 146.94 g/mol. IUPAC name: (2-cyanophenyl)boronic acid. InChIKey: NPLZNDDFVCGRAG-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BNO2
Molecular weight146.94 g/mol
IUPAC name(2-cyanophenyl)boronic acid
InChIKeyNPLZNDDFVCGRAG-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1C#N)(O)O

Computed by PubChem (NCBI)