CAS 1386462-30-1 is the registry number for 3-(3-Chloro-2-fluorophenyl)-3-oxetanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
3-(3-chloro-2-fluorophenyl)oxetan-3-amine;hydrochloride (CAS 1386462-30-1) is a chemical compound with the molecular formula C9H10Cl2FNO and a molecular weight of 238.08 g/mol. IUPAC name: 3-(3-chloro-2-fluorophenyl)oxetan-3-amine;hydrochloride. InChIKey: RTZGOBYJMUSIHL-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2FNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 3-(3-chloro-2-fluorophenyl)oxetan-3-amine;hydrochloride |
| InChIKey | RTZGOBYJMUSIHL-UHFFFAOYSA-N |
| SMILES | C1C(CO1)(C2=C(C(=CC=C2)Cl)F)N.Cl |
Computed by PubChem (NCBI)