Products 138651-04-4
CAS 138651-04-4 appears in our catalog under these names: 6–Chloro–3–(3–(trifluoromethyl)phenyl)pyridazin–4–ol, 4-PYRIDAZINOL, 6-CHLORO-3-[3-(TRIFLUOROMETHYL)PHENYL]-, 95%+. Offered by: GLPBio, Chemat. Available pack sizes: 1mg, 25mg, 5mg, 10mg, 100mg.
6-chloro-3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-4-one (CAS 138651-04-4) is a chemical compound with the molecular formula C11H6ClF3N2O and a molecular weight of 274.62 g/mol. IUPAC name: 6-chloro-3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-4-one. InChIKey: JMVHGIGDPOBNFG-UHFFFAOYSA-N.
| Molecular formula | C11H6ClF3N2O |
|---|---|
| Molecular weight | 274.62 g/mol |
| IUPAC name | 6-chloro-3-[3-(trifluoromethyl)phenyl]-1H-pyridazin-4-one |
| InChIKey | JMVHGIGDPOBNFG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=NNC(=CC2=O)Cl |
Computed by PubChem (NCBI)