CAS 138685-83-3 appears in our catalog under these names: N-Carboxybenzyl Gemcitabine, N-Cbz gemcitabine. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 5mg, 25mg.
Benzyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate (CAS 138685-83-3) is a chemical compound with the molecular formula C17H17F2N3O6 and a molecular weight of 397.3 g/mol. IUPAC name: benzyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate. InChIKey: KFZMOOGZFANFGH-MRVWCRGKSA-N.
| Molecular formula | C17H17F2N3O6 |
|---|---|
| Molecular weight | 397.3 g/mol |
| IUPAC name | benzyl N-[1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxopyrimidin-4-yl]carbamate |
| InChIKey | KFZMOOGZFANFGH-MRVWCRGKSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=NC(=O)N(C=C2)[C@H]3C([C@@H]([C@H](O3)CO)O)(F)F |
Computed by PubChem (NCBI)