CAS 1386915-48-5 appears in our catalog under these names: Ambrisentan sodium salt, Ambrisentan sodium, Ambrisentan (sodium). Offered by: TRC, TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
Sodium (2S)-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate (CAS 1386915-48-5) is a chemical compound with the molecular formula C22H21N2NaO4 and a molecular weight of 400.4 g/mol. IUPAC name: sodium (2S)-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate. InChIKey: GNDMILPGCDIGHE-FSRHSHDFSA-M.
| Molecular formula | C22H21N2NaO4 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | sodium (2S)-2-(4,6-dimethylpyrimidin-2-yl)oxy-3-methoxy-3,3-diphenylpropanoate |
| InChIKey | GNDMILPGCDIGHE-FSRHSHDFSA-M |
| SMILES | CC1=CC(=NC(=N1)O[C@H](C(=O)[O-])C(C2=CC=CC=C2)(C3=CC=CC=C3)OC)C.[Na+] |
Computed by PubChem (NCBI)