Products 1386987-94-5
CAS 1386987-94-5 is the registry number for 4-Methoxymethyl-2,3,5,6-tetrafluorobenzyl-d3 Alcohol. Offered by: TRC. Available pack sizes: 100mg.
[2,3,5,6-tetrafluoro-4-(trideuteriomethoxymethyl)phenyl]methanol (CAS 1386987-94-5) is a chemical compound with the molecular formula C9H8F4O2 and a molecular weight of 227.17 g/mol. IUPAC name: [2,3,5,6-tetrafluoro-4-(trideuteriomethoxymethyl)phenyl]methanol. InChIKey: YFHZSPDQKWFAPH-FIBGUPNXSA-N.
| Molecular formula | C9H8F4O2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | [2,3,5,6-tetrafluoro-4-(trideuteriomethoxymethyl)phenyl]methanol |
| InChIKey | YFHZSPDQKWFAPH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OCC1=C(C(=C(C(=C1F)F)CO)F)F |
Computed by PubChem (NCBI)