CAS 13870-30-9 is the registry number for Sodium silicate (Na2Si3O7), 35% in H2O, 35% in H2O. Offered by: Chemat. Available pack sizes: 100g, 25g.
Disodium;bis[[oxido(oxo)silyl]oxy]-oxosilane (CAS 13870-30-9) is a chemical compound with the molecular formula Na2O7Si3 and a molecular weight of 242.23 g/mol. IUPAC name: disodium;bis[[oxido(oxo)silyl]oxy]-oxosilane. InChIKey: LDFLGRMLQPMMKX-UHFFFAOYSA-N.
| Molecular formula | Na2O7Si3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | disodium;bis[[oxido(oxo)silyl]oxy]-oxosilane |
| InChIKey | LDFLGRMLQPMMKX-UHFFFAOYSA-N |
| SMILES | [O-][Si](=O)O[Si](=O)O[Si](=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)