Products 138722-71-1
CAS 138722-71-1 is the registry number for 2,4-Diphenyl-6,7-dihydro-5H-cyclopenta(d)pyrimidine, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,4-diphenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine (CAS 138722-71-1) is a chemical compound with the molecular formula C19H16N2 and a molecular weight of 272.3 g/mol. IUPAC name: 2,4-diphenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine. InChIKey: OQFNVGBVGLVVJD-UHFFFAOYSA-N.
| Molecular formula | C19H16N2 |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | 2,4-diphenyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine |
| InChIKey | OQFNVGBVGLVVJD-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N=C(N=C2C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)