CAS 13873-38-6 is the registry number for Dibromobis(2-methylpyridine)copper, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Dibromocopper;bis(2-methylpyridine) (CAS 13873-38-6) is a chemical compound with the molecular formula C12H14Br2CuN2 and a molecular weight of 409.61 g/mol. IUPAC name: dibromocopper;bis(2-methylpyridine). InChIKey: NDCNRZXNSVGTTK-UHFFFAOYSA-L.
| Molecular formula | C12H14Br2CuN2 |
|---|---|
| Molecular weight | 409.61 g/mol |
| IUPAC name | dibromocopper;bis(2-methylpyridine) |
| InChIKey | NDCNRZXNSVGTTK-UHFFFAOYSA-L |
| SMILES | CC1=CC=CC=N1.CC1=CC=CC=N1.[Cu](Br)Br |
Computed by PubChem (NCBI)