Products 138751-03-8
CAS 138751-03-8 appears in our catalog under these names: H-D-Phe(2-F)-OH 98%, (R)-2-Amino-2-(2-fluorophenyl)aceticacid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-2-(2-fluorophenyl)acetic acid (CAS 138751-03-8) is a chemical compound with the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. IUPAC name: (2R)-2-amino-2-(2-fluorophenyl)acetic acid. InChIKey: CGNMJIBUVDGMIY-SSDOTTSWSA-N.
| Molecular formula | C8H8FNO2 |
|---|---|
| Molecular weight | 169.15 g/mol |
| IUPAC name | (2R)-2-amino-2-(2-fluorophenyl)acetic acid |
| InChIKey | CGNMJIBUVDGMIY-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)N)F |
Computed by PubChem (NCBI)
Synonyms:
(alphaR)-alpha-Amino-2-fluorobenzeneacetic acid, (2R)-2-amino-2-(2-fluorophenyl)acetic acid, R-2-FluoroPhenylglycine, (2R)-Amino(2-fluorophenyl)acetic acid, (|_R)-|_-Amino-2-fluorobenzeneacetic acid, (I+/-R)-I+/--Amino-2-fluorobenzeneacetic acid, Benzeneacetic acid, alpha-amino-2-fluoro-, (alphaR)-