CAS 1387529-49-8 appears in our catalog under these names: 2-Iodo-n-methyl-n-p-tolylbenzamide, 95%, 2-Iodo-N-methyl-N-p-tolylbenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
5-bromo-2-iodo-N-methyl-N-(4-methylphenyl)benzamide (CAS 1387529-49-8) is a chemical compound with the molecular formula C15H13BrINO and a molecular weight of 430.08 g/mol. IUPAC name: 5-bromo-2-iodo-N-methyl-N-(4-methylphenyl)benzamide. InChIKey: GLKVVTRCJGFYAU-UHFFFAOYSA-N.
| Molecular formula | C15H13BrINO |
|---|---|
| Molecular weight | 430.08 g/mol |
| IUPAC name | 5-bromo-2-iodo-N-methyl-N-(4-methylphenyl)benzamide |
| InChIKey | GLKVVTRCJGFYAU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C)C(=O)C2=C(C=CC(=C2)Br)I |
Computed by PubChem (NCBI)