CAS 1388043-57-9 is the registry number for 4-Bromo-1,3-dihydro-5-methyl-2H-benzimidazol-2-one. Offered by: TRC. Available pack sizes: 1g.
4-bromo-5-methyl-1,3-dihydrobenzimidazol-2-one (CAS 1388043-57-9) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 4-bromo-5-methyl-1,3-dihydrobenzimidazol-2-one. InChIKey: CPMHCYCGMWHVQG-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 4-bromo-5-methyl-1,3-dihydrobenzimidazol-2-one |
| InChIKey | CPMHCYCGMWHVQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)NC(=O)N2)Br |
Computed by PubChem (NCBI)