CAS 1388075-92-0 is the registry number for 2-Bromo-6-chloro-1H-indole. Offered by: TRC. Available pack sizes: 2,5g.
2-bromo-6-chloro-1H-indole (CAS 1388075-92-0) is a chemical compound with the molecular formula C8H5BrClN and a molecular weight of 230.49 g/mol. IUPAC name: 2-bromo-6-chloro-1H-indole. InChIKey: HTTQECYVRKWWJY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN |
|---|---|
| Molecular weight | 230.49 g/mol |
| IUPAC name | 2-bromo-6-chloro-1H-indole |
| InChIKey | HTTQECYVRKWWJY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)NC(=C2)Br |
Computed by PubChem (NCBI)