Products 1388085-41-3
CAS 1388085-41-3 is the registry number for (R)-alpha-(2,2-dimethylpropyl)-1-methyl-1H-pyrrole-3-methanamine. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-3,3-dimethyl-1-(1-methylpyrrol-3-yl)butan-1-amine (CAS 1388085-41-3) is a chemical compound with the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. IUPAC name: (1R)-3,3-dimethyl-1-(1-methylpyrrol-3-yl)butan-1-amine. InChIKey: PVKIKTCISFBVQF-SNVBAGLBSA-N.
| Molecular formula | C11H20N2 |
|---|---|
| Molecular weight | 180.29 g/mol |
| IUPAC name | (1R)-3,3-dimethyl-1-(1-methylpyrrol-3-yl)butan-1-amine |
| InChIKey | PVKIKTCISFBVQF-SNVBAGLBSA-N |
| SMILES | CC(C)(C)C[C@H](C1=CN(C=C1)C)N |
Computed by PubChem (NCBI)