CAS 1388094-58-3 is the registry number for (R)-6-Ethyl-2-methyl-1,2,3,4-tetrahydroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-6-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline (CAS 1388094-58-3) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (2R)-6-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline. InChIKey: MGKBQIMXJAUDQH-SECBINFHSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (2R)-6-ethyl-2-methyl-1,2,3,4-tetrahydroquinoline |
| InChIKey | MGKBQIMXJAUDQH-SECBINFHSA-N |
| SMILES | CCC1=CC2=C(C=C1)N[C@@H](CC2)C |
Computed by PubChem (NCBI)