CAS 13884-92-9 is the registry number for (Phenylthio)methyltriphenylphosphonium Chloride. Offered by: TRC. Available pack sizes: 250mg, 2g, 5g.
Triphenyl(phenylsulfanylmethyl)phosphanium chloride (CAS 13884-92-9) is a chemical compound with the molecular formula C25H22ClPS and a molecular weight of 420.9 g/mol. IUPAC name: triphenyl(phenylsulfanylmethyl)phosphanium chloride. InChIKey: OAUXBAZCEXSXGL-UHFFFAOYSA-M.
| Molecular formula | C25H22ClPS |
|---|---|
| Molecular weight | 420.9 g/mol |
| IUPAC name | triphenyl(phenylsulfanylmethyl)phosphanium chloride |
| InChIKey | OAUXBAZCEXSXGL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CSC2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-] |
Computed by PubChem (NCBI)