Products 13884-92-9

CAS 13884-92-9 is the registry number for (Phenylthio)methyltriphenylphosphonium Chloride. Offered by: TRC. Available pack sizes: 250mg, 2g, 5g.

Structural formula: {0} (CAS {1})

Triphenyl(phenylsulfanylmethyl)phosphanium chloride (CAS 13884-92-9) is a chemical compound with the molecular formula C25H22ClPS and a molecular weight of 420.9 g/mol. IUPAC name: triphenyl(phenylsulfanylmethyl)phosphanium chloride. InChIKey: OAUXBAZCEXSXGL-UHFFFAOYSA-M.

Identity
Molecular formulaC25H22ClPS
Molecular weight420.9 g/mol
IUPAC nametriphenyl(phenylsulfanylmethyl)phosphanium chloride
InChIKeyOAUXBAZCEXSXGL-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)[P+](CSC2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]

Computed by PubChem (NCBI)