Products 138847-50-4
CAS 138847-50-4 is the registry number for 2,2'-Thiobis(ethanol)-13C4. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
2-(2-hydroxy(1,2-13C2)ethylsulfanyl)(1,2-13C2)ethanol (CAS 138847-50-4) is a chemical compound with the molecular formula C4H10O2S and a molecular weight of 126.16 g/mol. IUPAC name: 2-(2-hydroxy(1,2-13C2)ethylsulfanyl)(1,2-13C2)ethanol. InChIKey: YODZTKMDCQEPHD-JCDJMFQYSA-N.
| Molecular formula | C4H10O2S |
|---|---|
| Molecular weight | 126.16 g/mol |
| IUPAC name | 2-(2-hydroxy(1,2-13C2)ethylsulfanyl)(1,2-13C2)ethanol |
| InChIKey | YODZTKMDCQEPHD-JCDJMFQYSA-N |
| SMILES | [13CH2]([13CH2]S[13CH2][13CH2]O)O |
Computed by PubChem (NCBI)