Products 138870-97-0
CAS 138870-97-0 is the registry number for ADHPE. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg.
[(3S,5S)-5-acetyloxy-1,7-bis(3,4-dihydroxyphenyl)heptan-3-yl] acetate (CAS 138870-97-0) is a chemical compound with the molecular formula C23H28O8 and a molecular weight of 432.5 g/mol. IUPAC name: [(3S,5S)-5-acetyloxy-1,7-bis(3,4-dihydroxyphenyl)heptan-3-yl] acetate. InChIKey: BWSFBLYFHGZBRQ-OALUTQOASA-N.
| Molecular formula | C23H28O8 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | [(3S,5S)-5-acetyloxy-1,7-bis(3,4-dihydroxyphenyl)heptan-3-yl] acetate |
| InChIKey | BWSFBLYFHGZBRQ-OALUTQOASA-N |
| SMILES | CC(=O)O[C@@H](CCC1=CC(=C(C=C1)O)O)C[C@H](CCC2=CC(=C(C=C2)O)O)OC(=O)C |
Computed by PubChem (NCBI)