CAS 1388701-30-1 is the registry number for 1-(1,3-Benzodioxol-5-yl)-2,2-dibromo-1-pentanone. Offered by: TRC. Available pack sizes: 100mg.
1-(1,3-benzodioxol-5-yl)-2,2-dibromopentan-1-one (CAS 1388701-30-1) is a chemical compound with the molecular formula C12H12Br2O3 and a molecular weight of 364.03 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2,2-dibromopentan-1-one. InChIKey: KPTSRTPXPVLIAJ-UHFFFAOYSA-N.
| Molecular formula | C12H12Br2O3 |
|---|---|
| Molecular weight | 364.03 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2,2-dibromopentan-1-one |
| InChIKey | KPTSRTPXPVLIAJ-UHFFFAOYSA-N |
| SMILES | CCCC(C(=O)C1=CC2=C(C=C1)OCO2)(Br)Br |
Computed by PubChem (NCBI)