CAS 138872-44-3 appears in our catalog under these names: 5-[(Benzoylamino)methyl]thiophene-2-sulfonyl chloride, 95%, 5-(Benzamidomethyl)thiophene-2-sulfonyl chloride, 97%, 5–(Benzamidomethyl)thiophene–2–sulfonyl chloride, 5-[(Benzoylamino)methyl]thiophene-2-sulfonyl chloride, 97% . Offered by: Combi-blocks, AmBeed, GLPBio, Thermo Scientific. Available pack sizes: 5g, 25g, 1g, 250mg.
5-(benzamidomethyl)thiophene-2-sulfonyl chloride (CAS 138872-44-3) is a chemical compound with the molecular formula C12H10ClNO3S2 and a molecular weight of 315.8 g/mol. IUPAC name: 5-(benzamidomethyl)thiophene-2-sulfonyl chloride. InChIKey: VGSWVDWOXYTAPG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3S2 |
|---|---|
| Molecular weight | 315.8 g/mol |
| IUPAC name | 5-(benzamidomethyl)thiophene-2-sulfonyl chloride |
| InChIKey | VGSWVDWOXYTAPG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NCC2=CC=C(S2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)