CAS 138872-73-8 appears in our catalog under these names: Deschloro Florfenicol, Florfenicol Impurity 2(Deschloro Florfenicol), Deschloro Florfenicol, >95% (HPLC), Florfenicol-deschloro, Deschloro Florfenicol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, HPC Standards. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 1x1ml.
2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide (CAS 138872-73-8) is a chemical compound with the molecular formula C12H15ClFNO4S and a molecular weight of 323.77 g/mol. IUPAC name: 2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide. InChIKey: ZGCDULJZLGMYDR-ZYHUDNBSSA-N.
| Molecular formula | C12H15ClFNO4S |
|---|---|
| Molecular weight | 323.77 g/mol |
| IUPAC name | 2-chloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-methylsulfonylphenyl)propan-2-yl]acetamide |
| InChIKey | ZGCDULJZLGMYDR-ZYHUDNBSSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](CF)NC(=O)CCl)O |
Computed by PubChem (NCBI)