Products 138876-40-1
CAS 138876-40-1 is the registry number for (2S,3S)-1-Benzhydryl-2-methylazetidin-3-ol, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
(2S,3S)-1-benzhydryl-2-methylazetidin-3-ol (CAS 138876-40-1) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: (2S,3S)-1-benzhydryl-2-methylazetidin-3-ol. InChIKey: RVJIUWJMJDLQIP-BBRMVZONSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | (2S,3S)-1-benzhydryl-2-methylazetidin-3-ol |
| InChIKey | RVJIUWJMJDLQIP-BBRMVZONSA-N |
| SMILES | C[C@H]1[C@H](CN1C(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)