CAS 1388827-79-9 is the registry number for Methyl (r)-5-amino-3-chloro-5,6,7,8-tetrahydronaphthalene-1-carboxylate hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (5R)-5-amino-3-chloro-5,6,7,8-tetrahydronaphthalene-1-carboxylate (CAS 1388827-79-9) is a chemical compound with the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. IUPAC name: methyl (5R)-5-amino-3-chloro-5,6,7,8-tetrahydronaphthalene-1-carboxylate. InChIKey: YTZDOEFPHOGKHT-LLVKDONJSA-N.
| Molecular formula | C12H14ClNO2 |
|---|---|
| Molecular weight | 239.70 g/mol |
| IUPAC name | methyl (5R)-5-amino-3-chloro-5,6,7,8-tetrahydronaphthalene-1-carboxylate |
| InChIKey | YTZDOEFPHOGKHT-LLVKDONJSA-N |
| SMILES | COC(=O)C1=CC(=CC2=C1CCC[C@H]2N)Cl |
Computed by PubChem (NCBI)