CAS 138900-27-3 is the registry number for Sertindole Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-1-(4-fluorophenyl)-3-piperidin-4-ylindole (CAS 138900-27-3) is a chemical compound with the molecular formula C19H18ClFN2 and a molecular weight of 328.8 g/mol. IUPAC name: 5-chloro-1-(4-fluorophenyl)-3-piperidin-4-ylindole. InChIKey: YCXCLZSLZGBCTA-UHFFFAOYSA-N.
| Molecular formula | C19H18ClFN2 |
|---|---|
| Molecular weight | 328.8 g/mol |
| IUPAC name | 5-chloro-1-(4-fluorophenyl)-3-piperidin-4-ylindole |
| InChIKey | YCXCLZSLZGBCTA-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C2=CN(C3=C2C=C(C=C3)Cl)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)