CAS 138908-40-4 appears in our catalog under these names: CL 316243 Disodium Salt, CL 316243/ 99.68% (existing batch purity), CL 316243, CL 316243, CL 316243 HYDRATE. Offered by: TRC, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 500mg, 5 mg.
Disodium;5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (CAS 138908-40-4) is a chemical compound with the molecular formula C20H18ClNNa2O7 and a molecular weight of 465.8 g/mol. IUPAC name: disodium;5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate. InChIKey: FUZBPOHHSBDTJQ-CFOQQKEYSA-L.
| Molecular formula | C20H18ClNNa2O7 |
|---|---|
| Molecular weight | 465.8 g/mol |
| IUPAC name | disodium;5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| InChIKey | FUZBPOHHSBDTJQ-CFOQQKEYSA-L |
| SMILES | C[C@H](CC1=CC2=C(C=C1)OC(O2)(C(=O)[O-])C(=O)[O-])NC[C@@H](C3=CC(=CC=C3)Cl)O.[Na+].[Na+] |
Computed by PubChem (NCBI)