CAS 1389133-90-7 is the registry number for tert-Butyl 2-[4,5-dichloro-6-oxo-1(6h)-pyridazinyl]acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)acetate (CAS 1389133-90-7) is a chemical compound with the molecular formula C10H12Cl2N2O3 and a molecular weight of 279.12 g/mol. IUPAC name: tert-butyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)acetate. InChIKey: QRXQXGIFINLATH-UHFFFAOYSA-N.
| Molecular formula | C10H12Cl2N2O3 |
|---|---|
| Molecular weight | 279.12 g/mol |
| IUPAC name | tert-butyl 2-(4,5-dichloro-6-oxopyridazin-1-yl)acetate |
| InChIKey | QRXQXGIFINLATH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C(=C(C=N1)Cl)Cl |
Computed by PubChem (NCBI)