Products 13893-39-5

CAS 13893-39-5 is the registry number for 2-Decenal, 2-hexyl-, ≥95%, mixture of cis and trans, ≥95%, mixture of cis and trans. Offered by: Chemat. Available pack sizes: 25g, 100g.

Structural formula: {0} (CAS {1})

2-hexyldec-2-enal (CAS 13893-39-5) is a chemical compound with the molecular formula C16H30O and a molecular weight of 238.41 g/mol. IUPAC name: 2-hexyldec-2-enal. InChIKey: RSBRHLFCWKXUSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC16H30O
Molecular weight238.41 g/mol
IUPAC name2-hexyldec-2-enal
InChIKeyRSBRHLFCWKXUSQ-UHFFFAOYSA-N
SMILESCCCCCCCC=C(CCCCCC)C=O

Computed by PubChem (NCBI)