CAS 1389320-24-4 appears in our catalog under these names: (S)-2-Trifluoromethylpiperidine hydrochloride, 95%, (S)-2-Trifluoromethylpiperidine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 5g, 25g, 2,5g, 2.5g.
(2S)-2-(trifluoromethyl)piperidine;hydrochloride (CAS 1389320-24-4) is a chemical compound with the molecular formula C6H11ClF3N and a molecular weight of 189.60 g/mol. IUPAC name: (2S)-2-(trifluoromethyl)piperidine;hydrochloride. InChIKey: LUBQESPBTCELOM-JEDNCBNOSA-N.
| Molecular formula | C6H11ClF3N |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | (2S)-2-(trifluoromethyl)piperidine;hydrochloride |
| InChIKey | LUBQESPBTCELOM-JEDNCBNOSA-N |
| SMILES | C1CCN[C@@H](C1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)