CAS 1389320-33-5 appears in our catalog under these names: (2S)-1,1,1-Trifluoro-3-methylbutan-2-amine hydrochloride, (S)-1,1,1-Trifluoro-3-methyl-2-butylaminehydrochloride, 97%. Offered by: Biosynth, Fluorochem. Available pack sizes: 5g, 0,5g, 50mg, 100mg, 1g.
(2S)-1,1,1-trifluoro-3-methylbutan-2-amine;hydrochloride (CAS 1389320-33-5) is a chemical compound with the molecular formula C5H11ClF3N and a molecular weight of 177.59 g/mol. IUPAC name: (2S)-1,1,1-trifluoro-3-methylbutan-2-amine;hydrochloride. InChIKey: WBDZKNFDWWBZJN-WCCKRBBISA-N.
| Molecular formula | C5H11ClF3N |
|---|---|
| Molecular weight | 177.59 g/mol |
| IUPAC name | (2S)-1,1,1-trifluoro-3-methylbutan-2-amine;hydrochloride |
| InChIKey | WBDZKNFDWWBZJN-WCCKRBBISA-N |
| SMILES | CC(C)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)