Products 1389346-30-8
CAS 1389346-30-8 is the registry number for (R)-2,2-Dimethyl-1-(3-(trifluoromethoxy)phenyl)propan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine (CAS 1389346-30-8) is a chemical compound with the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. IUPAC name: (1R)-2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine. InChIKey: DFYMUWWRAVHOAW-JTQLQIEISA-N.
| Molecular formula | C12H16F3NO |
|---|---|
| Molecular weight | 247.26 g/mol |
| IUPAC name | (1R)-2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]propan-1-amine |
| InChIKey | DFYMUWWRAVHOAW-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@H](C1=CC(=CC=C1)OC(F)(F)F)N |
Computed by PubChem (NCBI)