CAS 1389372-10-4 is the registry number for (S)-2,2-Dimethyl-1-(2,4,5-trifluorophenyl)propan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2-dimethyl-1-(2,4,5-trifluorophenyl)propan-1-amine (CAS 1389372-10-4) is a chemical compound with the molecular formula C11H14F3N and a molecular weight of 217.23 g/mol. IUPAC name: (1S)-2,2-dimethyl-1-(2,4,5-trifluorophenyl)propan-1-amine. InChIKey: HBXPKYCJNXJXPI-SNVBAGLBSA-N.
| Molecular formula | C11H14F3N |
|---|---|
| Molecular weight | 217.23 g/mol |
| IUPAC name | (1S)-2,2-dimethyl-1-(2,4,5-trifluorophenyl)propan-1-amine |
| InChIKey | HBXPKYCJNXJXPI-SNVBAGLBSA-N |
| SMILES | CC(C)(C)[C@@H](C1=CC(=C(C=C1F)F)F)N |
Computed by PubChem (NCBI)