CAS 138966-60-6 is the registry number for 4,4'-(4-(tert-Butyl)cyclohexane-1,1-diyl)dianiline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[1-(4-aminophenyl)-4-tert-butylcyclohexyl]aniline (CAS 138966-60-6) is a chemical compound with the molecular formula C22H30N2 and a molecular weight of 322.5 g/mol. IUPAC name: 4-[1-(4-aminophenyl)-4-tert-butylcyclohexyl]aniline. InChIKey: JFMABLYWYIWATD-UHFFFAOYSA-N.
| Molecular formula | C22H30N2 |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | 4-[1-(4-aminophenyl)-4-tert-butylcyclohexyl]aniline |
| InChIKey | JFMABLYWYIWATD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCC(CC1)(C2=CC=C(C=C2)N)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)