CAS 1389935-19-6 appears in our catalog under these names: 6-((2,2,6,6-Tetramethylpiperidin-4-yl)amino)pyridine-3-carbonitrile, 95%, 6-((2,2,6,6-Tetramethylpiperidin-4-yl)amino)pyridine-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonitrile (CAS 1389935-19-6) is a chemical compound with the molecular formula C15H22N4 and a molecular weight of 258.36 g/mol. IUPAC name: 6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonitrile. InChIKey: OFWSZCALJFONJX-UHFFFAOYSA-N.
| Molecular formula | C15H22N4 |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | 6-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyridine-3-carbonitrile |
| InChIKey | OFWSZCALJFONJX-UHFFFAOYSA-N |
| SMILES | CC1(CC(CC(N1)(C)C)NC2=NC=C(C=C2)C#N)C |
Computed by PubChem (NCBI)