CAS 1390641-82-3 is the registry number for Tetrakis(4–ethynylphenyl)silane. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
Tetrakis(4-ethynylphenyl)silane (CAS 1390641-82-3) is a chemical compound with the molecular formula C32H20Si and a molecular weight of 432.6 g/mol. IUPAC name: tetrakis(4-ethynylphenyl)silane. InChIKey: KLDGWROBZSJZOH-UHFFFAOYSA-N.
| Molecular formula | C32H20Si |
|---|---|
| Molecular weight | 432.6 g/mol |
| IUPAC name | tetrakis(4-ethynylphenyl)silane |
| InChIKey | KLDGWROBZSJZOH-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=C(C=C1)[Si](C2=CC=C(C=C2)C#C)(C3=CC=C(C=C3)C#C)C4=CC=C(C=C4)C#C |
Computed by PubChem (NCBI)