Products 1390641-90-3
CAS 1390641-90-3 is the registry number for TUG-905. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[2-fluoro-4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methylamino]phenyl]propanoic acid (CAS 1390641-90-3) is a chemical compound with the molecular formula C27H30FNO5S and a molecular weight of 499.6 g/mol. IUPAC name: 3-[2-fluoro-4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methylamino]phenyl]propanoic acid. InChIKey: ODIHLEYTPVYAPY-UHFFFAOYSA-N.
| Molecular formula | C27H30FNO5S |
|---|---|
| Molecular weight | 499.6 g/mol |
| IUPAC name | 3-[2-fluoro-4-[[3-[2-methyl-4-(3-methylsulfonylpropoxy)phenyl]phenyl]methylamino]phenyl]propanoic acid |
| InChIKey | ODIHLEYTPVYAPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OCCCS(=O)(=O)C)C2=CC=CC(=C2)CNC3=CC(=C(C=C3)CCC(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
orb1694986, agonist 13 [PMID: 22724451]