CAS 1391033-19-4 is the registry number for 3,3,3-Trideuterio-2,2-difluoro-propanoic Acid. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
3,3,3-trideuterio-2,2-difluoropropanoic acid (CAS 1391033-19-4) is a chemical compound with the molecular formula C3H4F2O2 and a molecular weight of 113.08 g/mol. IUPAC name: 3,3,3-trideuterio-2,2-difluoropropanoic acid. InChIKey: PMWGIVRHUIAIII-FIBGUPNXSA-N.
| Molecular formula | C3H4F2O2 |
|---|---|
| Molecular weight | 113.08 g/mol |
| IUPAC name | 3,3,3-trideuterio-2,2-difluoropropanoic acid |
| InChIKey | PMWGIVRHUIAIII-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)(F)F |
Computed by PubChem (NCBI)