Products 1391051-71-0
CAS 1391051-71-0 is the registry number for 3,5-Bis(isopropyl)phenyl 4-Isopropylphenyl Phenyl Phosphate. Offered by: TRC. Available pack sizes: 500mg.
[3,5-di(propan-2-yl)phenyl] phenyl (4-propan-2-ylphenyl) phosphate (CAS 1391051-71-0) is a chemical compound with the molecular formula C27H33O4P and a molecular weight of 452.5 g/mol. IUPAC name: [3,5-di(propan-2-yl)phenyl] phenyl (4-propan-2-ylphenyl) phosphate. InChIKey: YRHIJLBOQLOKIP-UHFFFAOYSA-N.
| Molecular formula | C27H33O4P |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | [3,5-di(propan-2-yl)phenyl] phenyl (4-propan-2-ylphenyl) phosphate |
| InChIKey | YRHIJLBOQLOKIP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC(=CC(=C3)C(C)C)C(C)C |
Computed by PubChem (NCBI)