CAS 1391051-87-8 is the registry number for Propamidine Monoamide Isethionate. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 100mg.
4-[3-(4-carbamimidoylphenoxy)propoxy]benzenecarboximidamide;2-hydroxyethanesulfonic acid (CAS 1391051-87-8) is a chemical compound with the molecular formula C19H26N4O6S and a molecular weight of 438.5 g/mol. IUPAC name: 4-[3-(4-carbamimidoylphenoxy)propoxy]benzenecarboximidamide;2-hydroxyethanesulfonic acid. InChIKey: GKRUSDNSUNFBSG-UHFFFAOYSA-N.
| Molecular formula | C19H26N4O6S |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 4-[3-(4-carbamimidoylphenoxy)propoxy]benzenecarboximidamide;2-hydroxyethanesulfonic acid |
| InChIKey | GKRUSDNSUNFBSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)OCCCOC2=CC=C(C=C2)C(=N)N.C(CS(=O)(=O)O)O |
Computed by PubChem (NCBI)