CAS 1391051-98-1 is the registry number for 2-(Methylsulfonyl)phenothiazine 5,5-Dioxide. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2-methylsulfonyl-10H-phenothiazine 5,5-dioxide (CAS 1391051-98-1) is a chemical compound with the molecular formula C13H11NO4S2 and a molecular weight of 309.4 g/mol. IUPAC name: 2-methylsulfonyl-10H-phenothiazine 5,5-dioxide. InChIKey: PMFPVNVEKDXYHB-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4S2 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | 2-methylsulfonyl-10H-phenothiazine 5,5-dioxide |
| InChIKey | PMFPVNVEKDXYHB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)S(=O)(=O)C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)