CAS 1391052-15-5 appears in our catalog under these names: Pioglitazone EP Impurity F, Pioglitazone Impurity 6(Pioglitazone EP Impurity F), Des((5-ethyl-2-pyridinyl)ethyl) Pioglitazone Dimer Ether Impurity. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
5-[[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (CAS 1391052-15-5) is a chemical compound with the molecular formula C20H16N2O5S2 and a molecular weight of 428.5 g/mol. IUPAC name: 5-[[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione. InChIKey: GEYIFUZAGWPGGA-UHFFFAOYSA-N.
| Molecular formula | C20H16N2O5S2 |
|---|---|
| Molecular weight | 428.5 g/mol |
| IUPAC name | 5-[[4-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | GEYIFUZAGWPGGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2C(=O)NC(=O)S2)OC3=CC=C(C=C3)CC4C(=O)NC(=O)S4 |
Computed by PubChem (NCBI)