CAS 1391052-30-4 appears in our catalog under these names: rac Lamivudine Acid-13C,15N2, Lamivudine-13C,15N2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1 mg.
(2R,5S)-5-(4-amino-2-oxo(213C,1,3-15N2)pyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid (CAS 1391052-30-4) is a chemical compound with the molecular formula C8H9N3O4S and a molecular weight of 246.22 g/mol. IUPAC name: (2R,5S)-5-(4-amino-2-oxo(213C,1,3-15N2)pyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid. InChIKey: PIIRVEZNDVLYQA-FDHQWECPSA-N.
| Molecular formula | C8H9N3O4S |
|---|---|
| Molecular weight | 246.22 g/mol |
| IUPAC name | (2R,5S)-5-(4-amino-2-oxo(213C,1,3-15N2)pyrimidin-1-yl)-1,3-oxathiolane-2-carboxylic acid |
| InChIKey | PIIRVEZNDVLYQA-FDHQWECPSA-N |
| SMILES | C1[C@H](O[C@H](S1)C(=O)O)[15N]2C=CC(=[15N][13C]2=O)N |
Computed by PubChem (NCBI)