CAS 1391052-52-0 appears in our catalog under these names: Levocetirizine Impurity 8, 1-((4-chlorophenyl)(phenyl)methyl)-4-(phenylsulfonyl)piperazine, 1-((4-Chlorophenyl)phenylmethyl)-4-(phenylsulfonyl)piperazine. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5g, 10g, 25g.
1-(benzenesulfonyl)-4-[(4-chlorophenyl)-phenylmethyl]piperazine (CAS 1391052-52-0) is a chemical compound with the molecular formula C23H23ClN2O2S and a molecular weight of 427.0 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-[(4-chlorophenyl)-phenylmethyl]piperazine. InChIKey: SPJJNZAAMVPVFV-UHFFFAOYSA-N.
| Molecular formula | C23H23ClN2O2S |
|---|---|
| Molecular weight | 427.0 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-[(4-chlorophenyl)-phenylmethyl]piperazine |
| InChIKey | SPJJNZAAMVPVFV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl)S(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)