CAS 1391052-74-6 is the registry number for Diacerein-13C6 (>85%). Offered by: TRC. Available pack sizes: 1mg.
4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid (CAS 1391052-74-6) is a chemical compound with the molecular formula C19H12O8 and a molecular weight of 374.25 g/mol. IUPAC name: 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid. InChIKey: TYNLGDBUJLVSMA-TXOINDPKSA-N.
| Molecular formula | C19H12O8 |
|---|---|
| Molecular weight | 374.25 g/mol |
| IUPAC name | 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid |
| InChIKey | TYNLGDBUJLVSMA-TXOINDPKSA-N |
| SMILES | CC(=O)OC1=CC(=CC2=C1C(=O)[13C]3=[13C](C2=O)[13CH]=[13CH][13CH]=[13C]3OC(=O)C)C(=O)O |
Computed by PubChem (NCBI)