Products 1391052-74-6

CAS 1391052-74-6 is the registry number for Diacerein-13C6 (>85%). Offered by: TRC. Available pack sizes: 1mg.

Structural formula: {0} (CAS {1})

4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid (CAS 1391052-74-6) is a chemical compound with the molecular formula C19H12O8 and a molecular weight of 374.25 g/mol. IUPAC name: 4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid. InChIKey: TYNLGDBUJLVSMA-TXOINDPKSA-N.

Identity
Molecular formulaC19H12O8
Molecular weight374.25 g/mol
IUPAC name4,5-diacetyloxy-9,10-dioxoanthracene-2-carboxylic acid
InChIKeyTYNLGDBUJLVSMA-TXOINDPKSA-N
SMILESCC(=O)OC1=CC(=CC2=C1C(=O)[13C]3=[13C](C2=O)[13CH]=[13CH][13CH]=[13C]3OC(=O)C)C(=O)O

Computed by PubChem (NCBI)

Synonyms: Diacerein-13C6