CAS 1391052-80-4 appears in our catalog under these names: 2,6-Diethyl-4-thioisonicotinamide, Ethionamide Impurity 5 (Ethionamide EP Impurity E). Offered by: Biosynth, Hubei YoungXin. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg, 200mg.
2,6-diethylpyridine-4-carbothioamide (CAS 1391052-80-4) is a chemical compound with the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. IUPAC name: 2,6-diethylpyridine-4-carbothioamide. InChIKey: KYPAKUOODAWMJJ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2S |
|---|---|
| Molecular weight | 194.30 g/mol |
| IUPAC name | 2,6-diethylpyridine-4-carbothioamide |
| InChIKey | KYPAKUOODAWMJJ-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=CC(=N1)CC)C(=S)N |
Computed by PubChem (NCBI)