CAS 1391052-92-8 is the registry number for 5-Chloro-1-methylimidazole-13C4. Offered by: TRC. Available pack sizes: 10mg.
5-chloro-1-(113C)methyl(2,4,5-13C3)imidazole (CAS 1391052-92-8) is a chemical compound with the molecular formula C4H5ClN2 and a molecular weight of 120.52 g/mol. IUPAC name: 5-chloro-1-(113C)methyl(2,4,5-13C3)imidazole. InChIKey: NYDGOZPYEABERA-JCDJMFQYSA-N.
| Molecular formula | C4H5ClN2 |
|---|---|
| Molecular weight | 120.52 g/mol |
| IUPAC name | 5-chloro-1-(113C)methyl(2,4,5-13C3)imidazole |
| InChIKey | NYDGOZPYEABERA-JCDJMFQYSA-N |
| SMILES | [13CH3]N1[13CH]=N[13CH]=[13C]1Cl |
Computed by PubChem (NCBI)