Products 1391052-96-2
CAS 1391052-96-2 appears in our catalog under these names: 2-(1-Ethoxyethylidene)malononitrile-13C2, Alpha-Cyano-Beta-methyl-Beta-ethoxyacrylonitrile-13C2. Offered by: MedChemExpress, TRC. Available pack sizes: 25 mg, 2.5 mg, 2,5mg, 25mg.
2-(1-ethoxy(1,2-13C2)ethylidene)propanedinitrile (CAS 1391052-96-2) is a chemical compound with the molecular formula C7H8N2O and a molecular weight of 138.14 g/mol. IUPAC name: 2-(1-ethoxy(1,2-13C2)ethylidene)propanedinitrile. InChIKey: BOSVWXDDFBSSIZ-PYASWXJZSA-N.
| Molecular formula | C7H8N2O |
|---|---|
| Molecular weight | 138.14 g/mol |
| IUPAC name | 2-(1-ethoxy(1,2-13C2)ethylidene)propanedinitrile |
| InChIKey | BOSVWXDDFBSSIZ-PYASWXJZSA-N |
| SMILES | CCO[13C](=C(C#N)C#N)[13CH3] |
Computed by PubChem (NCBI)